C28H45NO5 — CID 58311079
methyl (2R)-2-[2-[(3aR,4S)-2,2-dimethyl-5-(2-methyloct-7-enoyl)-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]-2-oxoethyl]oct-7-enoate (PubChem CID 58311079) has the molecular formula C28H45NO5 and a molecular weight of 475.67 g/mol. Its IUPAC name is methyl (2R)-2-[2-[(3aR,4S)-2,2-dimethyl-5-(2-methyloct-7-enoyl)-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]-2-oxoethyl]oct-7-enoate.
| Compound Name | methyl (2R)-2-[2-[(3aR,4S)-2,2-dimethyl-5-(2-methyloct-7-enoyl)-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]-2-oxoethyl]oct-7-enoate |
|---|---|
| PubChem CID | 58311079 |
| Molecular Formula | C28H45NO5 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.33 |
| IUPAC Name | methyl (2R)-2-[2-[(3aR,4S)-2,2-dimethyl-5-(2-methyloct-7-enoyl)-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]-2-oxoethyl]oct-7-enoate |
| SMILES | C=CCCCCC(C)C(=O)N1CC2OC(C)(C)C[C@@H]2[C@H]1C(=O)C[C@@H](CCCCC=C)C(=O)OC |
| InChI | InChI=1S/C28H45NO5/c1-7-9-11-13-15-20(3)26(31)29-19-24-22(18-28(4,5)34-24)25(29)23(30)17-21(27(32)33-6)16-14-12-10-8-2/h7-8,20-22,24-25H,1-2,9-19H2,3-6H3/t20?,21-,22+,24?,25+/m1/s1 |
| InChIKey | HRYVMAPPCPKGTM-KPAMWTGPSA-N |
| XLogP | 5.26 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|