C24H39NO5 — CID 58212525
methyl (2S,4S)-1-[(2S,3R)-2-(2-cyclopentyloxy-2-oxoethyl)-3-methylnon-8-enoyl]-4-methylpyrrolidine-2-carboxylate (PubChem CID 58212525) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is methyl (2S,4S)-1-[(2S,3R)-2-(2-cyclopentyloxy-2-oxoethyl)-3-methylnon-8-enoyl]-4-methylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-[(2S,3R)-2-(2-cyclopentyloxy-2-oxoethyl)-3-methylnon-8-enoyl]-4-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58212525 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | methyl (2S,4S)-1-[(2S,3R)-2-(2-cyclopentyloxy-2-oxoethyl)-3-methylnon-8-enoyl]-4-methylpyrrolidine-2-carboxylate |
| SMILES | C=CCCCC[C@@H](C)[C@H](CC(=O)OC1CCCC1)C(=O)N1C[C@@H](C)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C24H39NO5/c1-5-6-7-8-11-18(3)20(15-22(26)30-19-12-9-10-13-19)23(27)25-16-17(2)14-21(25)24(28)29-4/h5,17-21H,1,6-16H2,2-4H3/t17-,18+,20-,21-/m0/s1 |
| InChIKey | HOTHCNJDUNZURS-YHELAOLJSA-N |
| XLogP | 4.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|