C20H31NO5 — CID 58212641
tert-butyl (3R)-3-[(1R,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptane-5-carbonyl]dec-9-enoate (PubChem CID 58212641) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(1R,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptane-5-carbonyl]dec-9-enoate.
| Compound Name | tert-butyl (3R)-3-[(1R,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptane-5-carbonyl]dec-9-enoate |
|---|---|
| PubChem CID | 58212641 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | tert-butyl (3R)-3-[(1R,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptane-5-carbonyl]dec-9-enoate |
| SMILES | C=CCCCCC[C@H](CC(=O)OC(C)(C)C)C(=O)N1C[C@H]2C[C@H]1C(=O)O2 |
| InChI | InChI=1S/C20H31NO5/c1-5-6-7-8-9-10-14(11-17(22)26-20(2,3)4)18(23)21-13-15-12-16(21)19(24)25-15/h5,14-16H,1,6-13H2,2-4H3/t14-,15-,16+/m1/s1 |
| InChIKey | ZDGWIDUMRGJAAV-OAGGEKHMSA-N |
| XLogP | 3.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|