C11H24N2OS — CID 58311619
1-tert-butyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)piperidin-4-amine (PubChem CID 58311619) has the molecular formula C11H24N2OS and a molecular weight of 232.39 g/mol. Its IUPAC name is 1-tert-butyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)piperidin-4-amine.
| Compound Name | 1-tert-butyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)piperidin-4-amine |
|---|---|
| PubChem CID | 58311619 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-tert-butyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)piperidin-4-amine |
| SMILES | C=S(C)(=O)NC1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C11H24N2OS/c1-11(2,3)13-8-6-10(7-9-13)12-15(4,5)14/h10H,4,6-9H2,1-3,5H3,(H,12,14) |
| InChIKey | BDFCCGWOTAFKBB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|