C25H21F3N4O4S — CID 58311729
(2R)-1-[(5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidine-2-carboxylic acid (PubChem CID 58311729) has the molecular formula C25H21F3N4O4S and a molecular weight of 530.53 g/mol. Its IUPAC name is (2R)-1-[(5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58311729 |
| Molecular Formula | C25H21F3N4O4S |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | (2R)-1-[(5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(Cn2ncc3cc(/C=C4\SC(N5CCC[C@@H]5C(=O)O)=NC4=O)ccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H21F3N4O4S/c1-36-17-6-5-15(18(11-17)25(26,27)28)13-32-19-7-4-14(9-16(19)12-29-32)10-21-22(33)30-24(37-21)31-8-2-3-20(31)23(34)35/h4-7,9-12,20H,2-3,8,13H2,1H3,(H,34,35)/b21-10-/t20-/m1/s1 |
| InChIKey | BMHQHRANPOWOGO-FUZNYIRFSA-N |
| XLogP | 4.63 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|