C23H24N2O6 — CID 58317082
benzyl 4-[2-(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)ethyl]piperidine-1-carboxylate (PubChem CID 58317082) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is benzyl 4-[2-(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)ethyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[2-(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58317082 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | benzyl 4-[2-(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)ethyl]piperidine-1-carboxylate |
| SMILES | O=C1Cc2oc(=O)cc(CCC3CCN(C(=O)OCc4ccccc4)CC3)c2C(=O)N1 |
| InChI | InChI=1S/C23H24N2O6/c26-19-13-18-21(22(28)24-19)17(12-20(27)31-18)7-6-15-8-10-25(11-9-15)23(29)30-14-16-4-2-1-3-5-16/h1-5,12,15H,6-11,13-14H2,(H,24,26,28) |
| InChIKey | GPYZLPXSGPZBND-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|