C21H20N2O6 — CID 58317204
benzyl 3-[(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 58317204) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is benzyl 3-[(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-[(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58317204 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | benzyl 3-[(2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-4-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | O=C1Cc2oc(=O)cc(CC3CCN(C(=O)OCc4ccccc4)C3)c2C(=O)N1 |
| InChI | InChI=1S/C21H20N2O6/c24-17-10-16-19(20(26)22-17)15(9-18(25)29-16)8-14-6-7-23(11-14)21(27)28-12-13-4-2-1-3-5-13/h1-5,9,14H,6-8,10-12H2,(H,22,24,26) |
| InChIKey | AIUPERCTEUUNDH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|