C39H46N4O2+4 — CID 58320185
4,11,11,19-tetramethyl-6,17-bis(4-pyridin-1-ium-1-ylbutyl)-2,21-dioxa-10,13-diazoniapentacyclo[11.8.0.01,10.03,8.015,20]henicosa-3(8),4,6,9,13,15(20),16,18-octaene (PubChem CID 58320185) has the molecular formula C39H46N4O2+4 and a molecular weight of 602.82 g/mol. Its IUPAC name is 4,11,11,19-tetramethyl-6,17-bis(4-pyridin-1-ium-1-ylbutyl)-2,21-dioxa-10,13-diazoniapentacyclo[11.8.0.01,10.03,8.015,20]henicosa-3(8),4,6,9,13,15(20),16,18-octaene.
| Compound Name | 4,11,11,19-tetramethyl-6,17-bis(4-pyridin-1-ium-1-ylbutyl)-2,21-dioxa-10,13-diazoniapentacyclo[11.8.0.01,10.03,8.015,20]henicosa-3(8),4,6,9,13,15(20),16,18-octaene |
|---|---|
| PubChem CID | 58320185 |
| Molecular Formula | C39H46N4O2+4 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | 4,11,11,19-tetramethyl-6,17-bis(4-pyridin-1-ium-1-ylbutyl)-2,21-dioxa-10,13-diazoniapentacyclo[11.8.0.01,10.03,8.015,20]henicosa-3(8),4,6,9,13,15(20),16,18-octaene |
| SMILES | Cc1cc(CCCC[n+]2ccccc2)cc2c1OC13Oc4c(C)cc(CCCC[n+]5ccccc5)cc4C=[N+]1C(C)(C)C[N+]3=C2 |
| InChI | InChI=1S/C39H46N4O2/c1-30-23-32(15-7-13-21-40-17-9-5-10-18-40)25-34-27-42-29-38(3,4)43-28-35-26-33(16-8-14-22-41-19-11-6-12-20-41)24-31(2)37(35)45-39(42,43)44-36(30)34/h5-6,9-12,17-20,23-28H,7-8,13-16,21-22,29H2,1-4H3/q+4 |
| InChIKey | XIDHAVFKCUPYDR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 32.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|