C40H29O3S+ — CID 58320902
10-[9,9-bis(4-methoxyphenyl)fluoren-2-yl]thioxanthen-10-ium-9-one (PubChem CID 58320902) has the molecular formula C40H29O3S+ and a molecular weight of 589.74 g/mol. Its IUPAC name is 10-[9,9-bis(4-methoxyphenyl)fluoren-2-yl]thioxanthen-10-ium-9-one.
| Compound Name | 10-[9,9-bis(4-methoxyphenyl)fluoren-2-yl]thioxanthen-10-ium-9-one |
|---|---|
| PubChem CID | 58320902 |
| Molecular Formula | C40H29O3S+ |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | 10-[9,9-bis(4-methoxyphenyl)fluoren-2-yl]thioxanthen-10-ium-9-one |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)c3ccccc3-c3ccc(-[s+]4c5ccccc5c(=O)c5ccccc54)cc32)cc1 |
| InChI | InChI=1S/C40H29O3S/c1-42-28-19-15-26(16-20-28)40(27-17-21-29(43-2)22-18-27)35-12-6-3-9-31(35)32-24-23-30(25-36(32)40)44-37-13-7-4-10-33(37)39(41)34-11-5-8-14-38(34)44/h3-25H,1-2H3/q+1 |
| InChIKey | JQABWDMCXOUARG-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|