C31H31O2S2+ — CID 166446978
(8R,9S,13S,14S)-3-methoxy-13-methyl-2-thianthren-5-ium-5-yl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 166446978) has the molecular formula C31H31O2S2+ and a molecular weight of 499.72 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-methoxy-13-methyl-2-thianthren-5-ium-5-yl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-methoxy-13-methyl-2-thianthren-5-ium-5-yl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 166446978 |
| Molecular Formula | C31H31O2S2+ |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (8R,9S,13S,14S)-3-methoxy-13-methyl-2-thianthren-5-ium-5-yl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | COc1cc2c(cc1[S+]1c3ccccc3Sc3ccccc31)[C@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C31H31O2S2/c1-31-16-15-20-21(23(31)13-14-30(31)32)12-11-19-17-24(33-2)29(18-22(19)20)35-27-9-5-3-7-25(27)34-26-8-4-6-10-28(26)35/h3-10,17-18,20-21,23H,11-16H2,1-2H3/q+1/t20-,21+,23-,31-/m0/s1 |
| InChIKey | DIUIEZCHWAQAGH-LIKUKZONSA-N |
| XLogP | 7.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|