C32H31F3O6S2 — CID 165436426
(8R,9S,13S,14S)-3-methoxy-13-methyl-2-phenoxathiin-10-ium-10-yl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;trifluoromethanesulfonate (PubChem CID 165436426) has the molecular formula C32H31F3O6S2 and a molecular weight of 632.72 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-methoxy-13-methyl-2-phenoxathiin-10-ium-10-yl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;trifluoromethanesulfonate.
| Compound Name | (8R,9S,13S,14S)-3-methoxy-13-methyl-2-phenoxathiin-10-ium-10-yl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 165436426 |
| Molecular Formula | C32H31F3O6S2 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | (8R,9S,13S,14S)-3-methoxy-13-methyl-2-phenoxathiin-10-ium-10-yl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;trifluoromethanesulfonate |
| SMILES | COc1cc2c(cc1[S+]1c3ccccc3Oc3ccccc31)[C@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1CC2.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C31H31O3S.CHF3O3S/c1-31-16-15-20-21(23(31)13-14-30(31)32)12-11-19-17-26(33-2)29(18-22(19)20)35-27-9-5-3-7-24(27)34-25-8-4-6-10-28(25)35;2-1(3,4)8(5,6)7/h3-10,17-18,20-21,23H,11-16H2,1-2H3;(H,5,6,7)/q+1;/p-1/t20-,21+,23-,31-;/m0./s1 |
| InChIKey | UJNQTQKHQNVOGB-AUCXVWCVSA-M |
| XLogP | 7.37 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|