C34H33F5O4S — CID 155721972
[(3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-cyclohexylmethanone (PubChem CID 155721972) has the molecular formula C34H33F5O4S and a molecular weight of 632.69 g/mol. Its IUPAC name is [(3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-cyclohexylmethanone.
| Compound Name | [(3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 155721972 |
| Molecular Formula | C34H33F5O4S |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | [(3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-[[2-fluoro-6-(trifluoromethyl)phenyl]methoxy]-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-cyclohexylmethanone |
| SMILES | O=C(C1CCCCC1)C1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(OCc4c(F)cccc4C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C34H33F5O4S/c35-23-10-13-25(14-11-23)44(41,42)33-18-17-26(32(40)21-5-2-1-3-6-21)29(33)15-9-22-19-24(12-16-28(22)33)43-20-27-30(34(37,38)39)7-4-8-31(27)36/h4,7-8,10-14,16,19,21,26,29H,1-3,5-6,9,15,17-18,20H2/t26?,29-,33+/m0/s1 |
| InChIKey | YYPGVTCFJLCWFB-BYEIEXGZSA-N |
| XLogP | 8.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |