C35H43F5O4S — CID 91525550
(8S,9R,11S,13S,14S,16R)-13,16-dimethyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 91525550) has the molecular formula C35H43F5O4S and a molecular weight of 654.78 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S,16R)-13,16-dimethyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,9R,11S,13S,14S,16R)-13,16-dimethyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 91525550 |
| Molecular Formula | C35H43F5O4S |
| Molecular Weight | 654.78 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | (8S,9R,11S,13S,14S,16R)-13,16-dimethyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCc4ccccc4[C@H]3[C@@H](c3ccc(OCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc3)C[C@]2(C)C1=O |
| InChI | InChI=1S/C35H43F5O4S/c1-23-21-30-28-16-13-24-9-4-5-10-27(24)31(28)29(22-33(30,2)32(23)41)25-11-14-26(15-12-25)44-18-6-3-7-19-45(42,43)20-8-17-34(36,37)35(38,39)40/h4-5,9-12,14-15,23,28-31H,3,6-8,13,16-22H2,1-2H3/t23-,28+,29-,30+,31-,33+/m1/s1 |
| InChIKey | AORCVMGSJLAXCK-BNCRFHJESA-N |
| XLogP | 8.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.78 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|