C29H34F2O4S — CID 163297796
(8R,9S,13S,14S)-3-[5-(benzenesulfonyl)-5,5-difluoropentoxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 163297796) has the molecular formula C29H34F2O4S and a molecular weight of 516.65 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-[5-(benzenesulfonyl)-5,5-difluoropentoxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-[5-(benzenesulfonyl)-5,5-difluoropentoxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 163297796 |
| Molecular Formula | C29H34F2O4S |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | (8R,9S,13S,14S)-3-[5-(benzenesulfonyl)-5,5-difluoropentoxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCCC(F)(F)S(=O)(=O)c5ccccc5)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C29H34F2O4S/c1-28-17-15-24-23-12-10-21(19-20(23)9-11-25(24)26(28)13-14-27(28)32)35-18-6-5-16-29(30,31)36(33,34)22-7-3-2-4-8-22/h2-4,7-8,10,12,19,24-26H,5-6,9,11,13-18H2,1H3/t24-,25-,26+,28+/m1/s1 |
| InChIKey | DLBARYFSVRWCJR-CRFRDXJISA-N |
| XLogP | 6.73 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|