C30H33F3O4S — CID 139124957
(8R,9S,13S,14S)-13-methyl-3-[(1R,3S)-3-[4-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 139124957) has the molecular formula C30H33F3O4S and a molecular weight of 546.65 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-3-[(1R,3S)-3-[4-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-methyl-3-[(1R,3S)-3-[4-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 139124957 |
| Molecular Formula | C30H33F3O4S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-3-[(1R,3S)-3-[4-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O[C@@H]5CC[C@H](S(=O)(=O)c6ccc(C(F)(F)F)cc6)C5)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C30H33F3O4S/c1-29-15-14-25-24-11-6-20(16-18(24)2-10-26(25)27(29)12-13-28(29)34)37-21-5-9-23(17-21)38(35,36)22-7-3-19(4-8-22)30(31,32)33/h3-4,6-8,11,16,21,23,25-27H,2,5,9-10,12-15,17H2,1H3/t21-,23+,25-,26-,27+,29+/m1/s1 |
| InChIKey | ZFHYVNCDKJFNRN-AUNDFDBXSA-N |
| XLogP | 6.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |