C34H41F5O3S — CID 90694417
(8S,9R,11S,13S,14S)-13-methyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentoxy]phenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 90694417) has the molecular formula C34H41F5O3S and a molecular weight of 624.76 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S)-13-methyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentoxy]phenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,9R,11S,13S,14S)-13-methyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentoxy]phenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 90694417 |
| Molecular Formula | C34H41F5O3S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | (8S,9R,11S,13S,14S)-13-methyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfinyl)pentoxy]phenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12C[C@H](c3ccc(OCCCCCS(=O)CCCC(F)(F)C(F)(F)F)cc3)[C@@H]3c4ccccc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C34H41F5O3S/c1-32-22-28(31-26-9-4-3-8-23(26)12-15-27(31)29(32)16-17-30(32)40)24-10-13-25(14-11-24)42-19-5-2-6-20-43(41)21-7-18-33(35,36)34(37,38)39/h3-4,8-11,13-14,27-29,31H,2,5-7,12,15-22H2,1H3/t27-,28+,29-,31+,32-,43?/m0/s1 |
| InChIKey | PLLHHOPKIUFEFH-IMLDRZGLSA-N |
| XLogP | 8.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|