C25H28O2S — CID 138972452
(8R,9S,13S,14S)-3-(4-methoxyphenyl)sulfanyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 138972452) has the molecular formula C25H28O2S and a molecular weight of 392.56 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-(4-methoxyphenyl)sulfanyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-(4-methoxyphenyl)sulfanyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 138972452 |
| Molecular Formula | C25H28O2S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (8R,9S,13S,14S)-3-(4-methoxyphenyl)sulfanyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | COc1ccc(Sc2ccc3c(c2)CC[C@@H]2[C@@H]3CC[C@]3(C)C(=O)CC[C@@H]23)cc1 |
| InChI | InChI=1S/C25H28O2S/c1-25-14-13-21-20-10-8-19(28-18-6-4-17(27-2)5-7-18)15-16(20)3-9-22(21)23(25)11-12-24(25)26/h4-8,10,15,21-23H,3,9,11-14H2,1-2H3/t21-,22-,23+,25+/m1/s1 |
| InChIKey | HNPLZZCAZQKGFT-AHCIIZGASA-N |
| XLogP | 6.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |