C26H32O3S — CID 90672190
(7R,8R,9S,10R,13S,14S)-7-(4-methoxyphenyl)sulfanyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 90672190) has the molecular formula C26H32O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is (7R,8R,9S,10R,13S,14S)-7-(4-methoxyphenyl)sulfanyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (7R,8R,9S,10R,13S,14S)-7-(4-methoxyphenyl)sulfanyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 90672190 |
| Molecular Formula | C26H32O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (7R,8R,9S,10R,13S,14S)-7-(4-methoxyphenyl)sulfanyl-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | COc1ccc(S[C@@H]2CC3=CC(=O)CC[C@]3(C)[C@H]3CC[C@]4(C)C(=O)CC[C@H]4[C@H]23)cc1 |
| InChI | InChI=1S/C26H32O3S/c1-25-12-10-17(27)14-16(25)15-22(30-19-6-4-18(29-3)5-7-19)24-20-8-9-23(28)26(20,2)13-11-21(24)25/h4-7,14,20-22,24H,8-13,15H2,1-3H3/t20-,21-,22+,24-,25-,26-/m0/s1 |
| InChIKey | NBHRMDBTHQGGPL-BIUJGKDFSA-N |
| XLogP | 5.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |