C20H27NO2 — CID 58324741
benzyl 2-[(1R,3S)-5-(aminomethyl)-2-adamantyl]acetate (PubChem CID 58324741) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is benzyl 2-[(1R,3S)-5-(aminomethyl)-2-adamantyl]acetate.
| Compound Name | benzyl 2-[(1R,3S)-5-(aminomethyl)-2-adamantyl]acetate |
|---|---|
| PubChem CID | 58324741 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | benzyl 2-[(1R,3S)-5-(aminomethyl)-2-adamantyl]acetate |
| SMILES | NCC12CC3C[C@H](C1)C(CC(=O)OCc1ccccc1)[C@@H](C3)C2 |
| InChI | InChI=1S/C20H27NO2/c21-13-20-9-15-6-16(10-20)18(17(7-15)11-20)8-19(22)23-12-14-4-2-1-3-5-14/h1-5,15-18H,6-13,21H2/t15?,16-,17+,18?,20? |
| InChIKey | PCOGOWRLUJTNOJ-QBZDVNTPSA-N |
| XLogP | 3.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |