C26H33N3O6 — CID 58328187
4-(2,4-dimethoxybenzoyl)-N-[5-(4-methoxybutanoyl)-2-methylphenyl]piperazine-1-carboxamide (PubChem CID 58328187) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-(2,4-dimethoxybenzoyl)-N-[5-(4-methoxybutanoyl)-2-methylphenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2,4-dimethoxybenzoyl)-N-[5-(4-methoxybutanoyl)-2-methylphenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58328187 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 4-(2,4-dimethoxybenzoyl)-N-[5-(4-methoxybutanoyl)-2-methylphenyl]piperazine-1-carboxamide |
| SMILES | COCCCC(=O)c1ccc(C)c(NC(=O)N2CCN(C(=O)c3ccc(OC)cc3OC)CC2)c1 |
| InChI | InChI=1S/C26H33N3O6/c1-18-7-8-19(23(30)6-5-15-33-2)16-22(18)27-26(32)29-13-11-28(12-14-29)25(31)21-10-9-20(34-3)17-24(21)35-4/h7-10,16-17H,5-6,11-15H2,1-4H3,(H,27,32) |
| InChIKey | KYXMOWZHYWCUNT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|