C21H22F3IrN2O2- — CID 58330987
iridium;2-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;pentane-2,4-diol (PubChem CID 58330987) has the molecular formula C21H22F3IrN2O2- and a molecular weight of 583.63 g/mol. Its IUPAC name is iridium;2-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;pentane-2,4-diol.
| Compound Name | iridium;2-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;pentane-2,4-diol |
|---|---|
| PubChem CID | 58330987 |
| Molecular Formula | C21H22F3IrN2O2- |
| Molecular Weight | 583.63 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | iridium;2-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.Cc1nc2ccccc2nc1-c1[c-]cc(C(F)(F)F)cc1.[Ir] |
| InChI | InChI=1S/C16H10F3N2.C5H12O2.Ir/c1-10-15(21-14-5-3-2-4-13(14)20-10)11-6-8-12(9-7-11)16(17,18)19;1-4(6)3-5(2)7;/h2-6,8-9H,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | IFRHZMJUFOBJCQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|