C21H22F3N2O4Pt- — CID 58330988
1,3-dimethoxypropane-1,3-diol;2-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;platinum (PubChem CID 58330988) has the molecular formula C21H22F3N2O4Pt- and a molecular weight of 618.49 g/mol. Its IUPAC name is 1,3-dimethoxypropane-1,3-diol;2-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;platinum.
| Compound Name | 1,3-dimethoxypropane-1,3-diol;2-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;platinum |
|---|---|
| PubChem CID | 58330988 |
| Molecular Formula | C21H22F3N2O4Pt- |
| Molecular Weight | 618.49 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | 1,3-dimethoxypropane-1,3-diol;2-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;platinum |
| SMILES | COC(O)CC(O)OC.Cc1nc2ccccc2nc1-c1[c-]cc(C(F)(F)F)cc1.[Pt] |
| InChI | InChI=1S/C16H10F3N2.C5H12O4.Pt/c1-10-15(21-14-5-3-2-4-13(14)20-10)11-6-8-12(9-7-11)16(17,18)19;1-8-4(6)3-5(7)9-2;/h2-6,8-9H,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | JFZBOTBRZKBMFQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|