C27H23F6IrN2O4- — CID 58672276
1,3-dimethoxypropane-1,3-diol;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]quinoxaline (PubChem CID 58672276) has the molecular formula C27H23F6IrN2O4- and a molecular weight of 745.70 g/mol. Its IUPAC name is 1,3-dimethoxypropane-1,3-diol;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]quinoxaline.
| Compound Name | 1,3-dimethoxypropane-1,3-diol;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]quinoxaline |
|---|---|
| PubChem CID | 58672276 |
| Molecular Formula | C27H23F6IrN2O4- |
| Molecular Weight | 745.70 g/mol |
| Exact Mass | 746.12 |
| IUPAC Name | 1,3-dimethoxypropane-1,3-diol;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]quinoxaline |
| SMILES | COC(O)CC(O)OC.FC(F)(F)c1c[c-]c(-c2nc3ccccc3nc2-c2ccc(C(F)(F)F)cc2)cc1.[Ir] |
| InChI | InChI=1S/C22H11F6N2.C5H12O4.Ir/c23-21(24,25)15-9-5-13(6-10-15)19-20(30-18-4-2-1-3-17(18)29-19)14-7-11-16(12-8-14)22(26,27)28;1-8-4(6)3-5(7)9-2;/h1-7,9-12H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | NNNFSBNCCUVFMQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.70 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|