C20H22ClN2O4Pt- — CID 58330975
2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;1,3-dimethoxypropane-1,3-diol;platinum (PubChem CID 58330975) has the molecular formula C20H22ClN2O4Pt- and a molecular weight of 584.94 g/mol. Its IUPAC name is 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;1,3-dimethoxypropane-1,3-diol;platinum.
| Compound Name | 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;1,3-dimethoxypropane-1,3-diol;platinum |
|---|---|
| PubChem CID | 58330975 |
| Molecular Formula | C20H22ClN2O4Pt- |
| Molecular Weight | 584.94 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | 2-(4-chlorobenzene-6-id-1-yl)-3-methylquinoxaline;1,3-dimethoxypropane-1,3-diol;platinum |
| SMILES | COC(O)CC(O)OC.Cc1nc2ccccc2nc1-c1[c-]cc(Cl)cc1.[Pt] |
| InChI | InChI=1S/C15H10ClN2.C5H12O4.Pt/c1-10-15(11-6-8-12(16)9-7-11)18-14-5-3-2-4-13(14)17-10;1-8-4(6)3-5(7)9-2;/h2-6,8-9H,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | VHMTYWZESSDRFH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|