C18H25N3O2S — CID 58331977
N-(1,3-benzothiazol-2-ylmethyl)-3-(tert-butylamino)-2-oxohexanamide (PubChem CID 58331977) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-3-(tert-butylamino)-2-oxohexanamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-3-(tert-butylamino)-2-oxohexanamide |
|---|---|
| PubChem CID | 58331977 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-3-(tert-butylamino)-2-oxohexanamide |
| SMILES | CCCC(NC(C)(C)C)C(=O)C(=O)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H25N3O2S/c1-5-8-13(21-18(2,3)4)16(22)17(23)19-11-15-20-12-9-6-7-10-14(12)24-15/h6-7,9-10,13,21H,5,8,11H2,1-4H3,(H,19,23) |
| InChIKey | SQNKOBOFQNCRDG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|