C10H7ClF2N2OS — CID 86817053
N-(1,3-benzothiazol-2-ylmethyl)-2-chloro-2,2-difluoroacetamide (PubChem CID 86817053) has the molecular formula C10H7ClF2N2OS and a molecular weight of 276.70 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2-chloro-2,2-difluoroacetamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2-chloro-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 86817053 |
| Molecular Formula | C10H7ClF2N2OS |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2-chloro-2,2-difluoroacetamide |
| SMILES | O=C(NCc1nc2ccccc2s1)C(F)(F)Cl |
| InChI | InChI=1S/C10H7ClF2N2OS/c11-10(12,13)9(16)14-5-8-15-6-3-1-2-4-7(6)17-8/h1-4H,5H2,(H,14,16) |
| InChIKey | UZKOWVXZGSKPOO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|