C36H59N4O2S+ — CID 58335220
[1-methyl-4-(2-methyl-5,10-dihydro-4H-thieno[3,2-c][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2-octyldecanoate (PubChem CID 58335220) has the molecular formula C36H59N4O2S+ and a molecular weight of 611.96 g/mol. Its IUPAC name is [1-methyl-4-(2-methyl-5,10-dihydro-4H-thieno[3,2-c][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2-octyldecanoate.
| Compound Name | [1-methyl-4-(2-methyl-5,10-dihydro-4H-thieno[3,2-c][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2-octyldecanoate |
|---|---|
| PubChem CID | 58335220 |
| Molecular Formula | C36H59N4O2S+ |
| Molecular Weight | 611.96 g/mol |
| Exact Mass | 611.44 |
| IUPAC Name | [1-methyl-4-(2-methyl-5,10-dihydro-4H-thieno[3,2-c][1,5]benzodiazepin-4-yl)piperazin-1-ium-1-yl]methyl 2-octyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)C(=O)OC[N+]1(C)CCN(C2Nc3ccccc3Nc3sc(C)cc32)CC1 |
| InChI | InChI=1S/C36H59N4O2S/c1-5-7-9-11-13-15-19-30(20-16-14-12-10-8-6-2)36(41)42-28-40(4)25-23-39(24-26-40)34-31-27-29(3)43-35(31)38-33-22-18-17-21-32(33)37-34/h17-18,21-22,27,30,34,37-38H,5-16,19-20,23-26,28H2,1-4H3/q+1 |
| InChIKey | AYKFZBTZCBNMDQ-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.96 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|