C8H16NO4Y- — CID 58335936
1-ethyl-2-(hydroxymethyl)piperidine-3,4,5-triol;yttrium (PubChem CID 58335936) has the molecular formula C8H16NO4Y- and a molecular weight of 279.12 g/mol. Its IUPAC name is 1-ethyl-2-(hydroxymethyl)piperidine-3,4,5-triol;yttrium.
| Compound Name | 1-ethyl-2-(hydroxymethyl)piperidine-3,4,5-triol;yttrium |
|---|---|
| PubChem CID | 58335936 |
| Molecular Formula | C8H16NO4Y- |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 1-ethyl-2-(hydroxymethyl)piperidine-3,4,5-triol;yttrium |
| SMILES | C[CH-]N1CC(O)C(O)C(O)C1CO.[Y] |
| InChI | InChI=1S/C8H16NO4.Y/c1-2-9-3-6(11)8(13)7(12)5(9)4-10;/h2,5-8,10-13H,3-4H2,1H3;/q-1; |
| InChIKey | DWPRMRHOLAFDQL-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|