C26H16Br4S4 — CID 58339904
5,12-dibromo-4,11-bis(2-bromo-4-ethylphenyl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene (PubChem CID 58339904) has the molecular formula C26H16Br4S4 and a molecular weight of 776.30 g/mol. Its IUPAC name is 5,12-dibromo-4,11-bis(2-bromo-4-ethylphenyl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene.
| Compound Name | 5,12-dibromo-4,11-bis(2-bromo-4-ethylphenyl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene |
|---|---|
| PubChem CID | 58339904 |
| Molecular Formula | C26H16Br4S4 |
| Molecular Weight | 776.30 g/mol |
| Exact Mass | 771.69 |
| IUPAC Name | 5,12-dibromo-4,11-bis(2-bromo-4-ethylphenyl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene |
| SMILES | CCc1ccc(-c2sc3c(sc4c5sc(-c6ccc(CC)cc6Br)c(Br)c5sc34)c2Br)c(Br)c1 |
| InChI | InChI=1S/C26H16Br4S4/c1-3-11-5-7-13(15(27)9-11)19-17(29)21-23(31-19)25-26(33-21)24-22(34-25)18(30)20(32-24)14-8-6-12(4-2)10-16(14)28/h5-10H,3-4H2,1-2H3 |
| InChIKey | FJBYJXHXIGWTQP-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.30 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |