C15H29F2NO2 — CID 58341579
4-[8-(2,2-difluoropropoxy)octyl]morpholine (PubChem CID 58341579) has the molecular formula C15H29F2NO2 and a molecular weight of 293.40 g/mol. Its IUPAC name is 4-[8-(2,2-difluoropropoxy)octyl]morpholine.
| Compound Name | 4-[8-(2,2-difluoropropoxy)octyl]morpholine |
|---|---|
| PubChem CID | 58341579 |
| Molecular Formula | C15H29F2NO2 |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 4-[8-(2,2-difluoropropoxy)octyl]morpholine |
| SMILES | CC(F)(F)COCCCCCCCCN1CCOCC1 |
| InChI | InChI=1S/C15H29F2NO2/c1-15(16,17)14-20-11-7-5-3-2-4-6-8-18-9-12-19-13-10-18/h2-14H2,1H3 |
| InChIKey | BXBRVLGSOPIBDW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|