C11H21B — CID 58343701
2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl(dimethyl)borane (PubChem CID 58343701) has the molecular formula C11H21B and a molecular weight of 164.10 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl(dimethyl)borane.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl(dimethyl)borane |
|---|---|
| PubChem CID | 58343701 |
| Molecular Formula | C11H21B |
| Molecular Weight | 164.10 g/mol |
| Exact Mass | 164.17 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl(dimethyl)borane |
| SMILES | CB(C)C1CCC2CCCC2C1 |
| InChI | InChI=1S/C11H21B/c1-12(2)11-7-6-9-4-3-5-10(9)8-11/h9-11H,3-8H2,1-2H3 |
| InChIKey | DIFKWSWYIZJVHU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.10 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|