C31H40N2O5 — CID 58348134
2-[(3S,6R,8E,11R)-11-benzyl-3-ethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2S)-4-hydroxybutan-2-yl]acetamide (PubChem CID 58348134) has the molecular formula C31H40N2O5 and a molecular weight of 520.67 g/mol. Its IUPAC name is 2-[(3S,6R,8E,11R)-11-benzyl-3-ethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2S)-4-hydroxybutan-2-yl]acetamide.
| Compound Name | 2-[(3S,6R,8E,11R)-11-benzyl-3-ethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2S)-4-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 58348134 |
| Molecular Formula | C31H40N2O5 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 2-[(3S,6R,8E,11R)-11-benzyl-3-ethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2S)-4-hydroxybutan-2-yl]acetamide |
| SMILES | CC[C@@H]1NC(=O)[C@@H](CC(=O)N[C@@H](C)CCO)C/C=C/C[C@H](Cc2ccccc2)C(=O)OC1c1ccccc1 |
| InChI | InChI=1S/C31H40N2O5/c1-3-27-29(24-14-8-5-9-15-24)38-31(37)26(20-23-12-6-4-7-13-23)17-11-10-16-25(30(36)33-27)21-28(35)32-22(2)18-19-34/h4-15,22,25-27,29,34H,3,16-21H2,1-2H3,(H,32,35)(H,33,36)/b11-10+/t22-,25+,26+,27-,29?/m0/s1 |
| InChIKey | XXEGMLKYCISEBA-KDZAABIUSA-N |
| XLogP | 4.27 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|