C25H31N3O10S2 — CID 58350591
[4-[[amino-[[3-methoxy-4-(3-sulfanylpropanoyloxy)phenyl]methoxycarbonylamino]methyl]carbamoyloxymethyl]-2-methoxyphenyl] 3-sulfanylpropanoate (PubChem CID 58350591) has the molecular formula C25H31N3O10S2 and a molecular weight of 597.67 g/mol. Its IUPAC name is [4-[[amino-[[3-methoxy-4-(3-sulfanylpropanoyloxy)phenyl]methoxycarbonylamino]methyl]carbamoyloxymethyl]-2-methoxyphenyl] 3-sulfanylpropanoate.
| Compound Name | [4-[[amino-[[3-methoxy-4-(3-sulfanylpropanoyloxy)phenyl]methoxycarbonylamino]methyl]carbamoyloxymethyl]-2-methoxyphenyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 58350591 |
| Molecular Formula | C25H31N3O10S2 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | [4-[[amino-[[3-methoxy-4-(3-sulfanylpropanoyloxy)phenyl]methoxycarbonylamino]methyl]carbamoyloxymethyl]-2-methoxyphenyl] 3-sulfanylpropanoate |
| SMILES | COc1cc(COC(=O)NC(N)NC(=O)OCc2ccc(OC(=O)CCS)c(OC)c2)ccc1OC(=O)CCS |
| InChI | InChI=1S/C25H31N3O10S2/c1-33-19-11-15(3-5-17(19)37-21(29)7-9-39)13-35-24(31)27-23(26)28-25(32)36-14-16-4-6-18(20(12-16)34-2)38-22(30)8-10-40/h3-6,11-12,23,39-40H,7-10,13-14,26H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | MVYPQBNGTFFGSZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 173.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|