C11H16O5 — CID 58351935
CID 58351935 (PubChem CID 58351935) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol.
| Compound Name | CID 58351935 |
|---|---|
| PubChem CID | 58351935 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | — |
| SMILES | [CH]OCC1OC(C)C(O[CH])C(O[CH])C1OC |
| InChI | InChI=1S/C11H16O5/c1-7-9(13-3)11(15-5)10(14-4)8(16-7)6-12-2/h2-3,5,7-11H,6H2,1,4H3 |
| InChIKey | BFHUPEZAWROWMA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |