About N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide
N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 58354718) has the molecular formula C17H20ClN3O3
and a molecular weight of 349.82 g/mol. Its IUPAC name is N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide |
| PubChem CID | 58354718 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | COc1cnc(NC(=O)C(C)(C)C)c(-c2cc(OC)ncc2Cl)c1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-17(2,3)16(22)21-15-12(6-10(23-4)8-20-15)11-7-14(24-5)19-9-13(11)18/h6-9H,1-5H3,(H,20,21,22) |
| InChIKey | SHELJIATBULGCK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide (CID 58354718) is N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide is COc1cnc(NC(=O)C(C)(C)C)c(-c2cc(OC)ncc2Cl)c1.
What is the InChIKey of N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide?
The InChIKey is SHELJIATBULGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O3/c1-17(2,3)16(22)21-15-12(6-10(23-4)8-20-15)11-7-14(24-5)19-9-13(11)18/h6-9H,1-5H3,(H,20,21,22).
What are the key properties of N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide?
N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide has a molecular weight of 349.82 g/mol, XLogP of 3.80, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(5-chloro-2-methoxy-4-pyridinyl)-5-methoxy-2-pyridinyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 58354718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).