About N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide
N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide (PubChem CID 59829116) has the molecular formula C10H12Cl2N2O
and a molecular weight of 247.12 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide |
| PubChem CID | 59829116 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O/c1-10(2,3)9(15)14-8-6(11)4-13-5-7(8)12/h4-5H,1-3H3,(H,13,14,15) |
| InChIKey | QXEZLSWMWZOXJD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide (CID 59829116) is N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1c(Cl)cncc1Cl.
What is the InChIKey of N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide?
The InChIKey is QXEZLSWMWZOXJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2N2O/c1-10(2,3)9(15)14-8-6(11)4-13-5-7(8)12/h4-5H,1-3H3,(H,13,14,15).
What are the key properties of N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide?
N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide has a molecular weight of 247.12 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichloro-4-pyridinyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 59829116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).