C27H30N2O4S2 — CID 58362837
(17R)-17-hydroxy-10,13-dimethyl-17-[2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetyl]-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 58362837) has the molecular formula C27H30N2O4S2 and a molecular weight of 510.68 g/mol. Its IUPAC name is (17R)-17-hydroxy-10,13-dimethyl-17-[2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetyl]-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (17R)-17-hydroxy-10,13-dimethyl-17-[2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetyl]-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 58362837 |
| Molecular Formula | C27H30N2O4S2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (17R)-17-hydroxy-10,13-dimethyl-17-[2-([1,3]thiazolo[5,4-b]pyridin-2-ylsulfanyl)acetyl]-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(=O)CC2(C)C1CC[C@]2(O)C(=O)CSc1nc2cccnc2s1 |
| InChI | InChI=1S/C27H30N2O4S2/c1-25-9-7-16(30)12-15(25)5-6-17-18-8-10-27(33,26(18,2)13-20(31)22(17)25)21(32)14-34-24-29-19-4-3-11-28-23(19)35-24/h3-4,11-12,17-18,22,33H,5-10,13-14H2,1-2H3/t17?,18?,22?,25?,26?,27-/m0/s1 |
| InChIKey | GSXQFZIWIKEFOK-CPBKTRSTSA-N |
| XLogP | 4.79 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'} |
|---|