C29H32ClNO5S — CID 58362926
(9R,11S,16R,17R)-17-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-9-chloro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 58362926) has the molecular formula C29H32ClNO5S and a molecular weight of 542.10 g/mol. Its IUPAC name is (9R,11S,16R,17R)-17-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-9-chloro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (9R,11S,16R,17R)-17-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-9-chloro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 58362926 |
| Molecular Formula | C29H32ClNO5S |
| Molecular Weight | 542.10 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | (9R,11S,16R,17R)-17-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-9-chloro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=CC4(C)[C@@]3(Cl)[C@@H](O)CC2(C)[C@@]1(O)C(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C29H32ClNO5S/c1-16-12-20-19-9-8-17-13-18(32)10-11-26(17,2)28(19,30)23(33)14-27(20,3)29(16,35)24(34)15-37-25-31-21-6-4-5-7-22(21)36-25/h4-7,10-11,13,16,19-20,23,33,35H,8-9,12,14-15H2,1-3H3/t16-,19?,20?,23+,26?,27?,28+,29+/m1/s1 |
| InChIKey | JXRBMKNJERDIKO-NDKHCRFJSA-N |
| XLogP | 5.11 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.10 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|