C27H30Cl2O6 — CID 90373744
3-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-chloro-17-(2-chloroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]furan-2-carboxylic acid (PubChem CID 90373744) has the molecular formula C27H30Cl2O6 and a molecular weight of 521.44 g/mol. Its IUPAC name is 3-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-chloro-17-(2-chloroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]furan-2-carboxylic acid.
| Compound Name | 3-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-chloro-17-(2-chloroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 90373744 |
| Molecular Formula | C27H30Cl2O6 |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 3-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-chloro-17-(2-chloroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]furan-2-carboxylic acid |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@]2(C)[C@]1(C(=O)CCl)c1ccoc1C(=O)O |
| InChI | InChI=1S/C27H30Cl2O6/c1-14-10-19-17-5-4-15-11-16(30)6-8-24(15,2)27(17,29)20(31)12-25(19,3)26(14,21(32)13-28)18-7-9-35-22(18)23(33)34/h6-9,11,14,17,19-20,31H,4-5,10,12-13H2,1-3H3,(H,33,34)/t14-,17+,19+,20+,24+,25+,26+,27+/m1/s1 |
| InChIKey | WBXGPUDAZREVBR-NQVAXBOFSA-N |
| XLogP | 4.91 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|