C21H26Cl2O4 — CID 45358402
(9R,10S,11S,14R,16R,17R)-9-chloro-17-(2-chloroacetyl)-11,17-dihydroxy-10,16-dimethyl-7,8,11,12,13,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 45358402) has the molecular formula C21H26Cl2O4 and a molecular weight of 413.34 g/mol. Its IUPAC name is (9R,10S,11S,14R,16R,17R)-9-chloro-17-(2-chloroacetyl)-11,17-dihydroxy-10,16-dimethyl-7,8,11,12,13,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (9R,10S,11S,14R,16R,17R)-9-chloro-17-(2-chloroacetyl)-11,17-dihydroxy-10,16-dimethyl-7,8,11,12,13,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 45358402 |
| Molecular Formula | C21H26Cl2O4 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (9R,10S,11S,14R,16R,17R)-9-chloro-17-(2-chloroacetyl)-11,17-dihydroxy-10,16-dimethyl-7,8,11,12,13,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1C[C@@H]2C(C[C@H](O)[C@@]3(Cl)C2CCC2=CC(=O)C=C[C@@]23C)[C@@]1(O)C(=O)CCl |
| InChI | InChI=1S/C21H26Cl2O4/c1-11-7-14-15-4-3-12-8-13(24)5-6-19(12,2)21(15,23)17(25)9-16(14)20(11,27)18(26)10-22/h5-6,8,11,14-17,25,27H,3-4,7,9-10H2,1-2H3/t11-,14+,15?,16?,17+,19+,20-,21+/m1/s1 |
| InChIKey | FSYKOOROHIBYBP-AQBFSBQISA-N |
| XLogP | 3.02 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|