C25H21F9NO8S3- — CID 58364027
[3-[4-[(6-butan-2-ylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 58364027) has the molecular formula C25H21F9NO8S3- and a molecular weight of 730.63 g/mol. Its IUPAC name is [3-[4-[(6-butan-2-ylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [3-[4-[(6-butan-2-ylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 58364027 |
| Molecular Formula | C25H21F9NO8S3- |
| Molecular Weight | 730.63 g/mol |
| Exact Mass | 730.03 |
| IUPAC Name | [3-[4-[(6-butan-2-ylnaphthalen-2-yl)oxymethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CCC(C)c1ccc2cc(OCc3ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc3)ccc2c1 |
| InChI | InChI=1S/C25H21F9NO8S3/c1-3-15(2)17-6-7-19-13-21(11-8-18(19)12-17)42-14-16-4-9-20(10-5-16)43-46(40,41)24(30,31)22(26,27)23(28,29)44(36,37)35-45(38,39)25(32,33)34/h4-13,15H,3,14H2,1-2H3/q-1 |
| InChIKey | BPPXGWAKKAIOPJ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 134.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.63 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|