C19H20Cl4N4O — CID 58378285
4-[(3,5-dichloro-4-pyridinyl)amino]-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one (PubChem CID 58378285) has the molecular formula C19H20Cl4N4O and a molecular weight of 462.21 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-pyridinyl)amino]-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one.
| Compound Name | 4-[(3,5-dichloro-4-pyridinyl)amino]-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 58378285 |
| Molecular Formula | C19H20Cl4N4O |
| Molecular Weight | 462.21 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 4-[(3,5-dichloro-4-pyridinyl)amino]-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one |
| SMILES | O=C(CCCNc1c(Cl)cncc1Cl)C1CCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C19H20Cl4N4O/c20-13-8-24-9-14(21)18(13)26-5-1-2-17(28)12-3-6-27(7-4-12)19-15(22)10-25-11-16(19)23/h8-12H,1-7H2,(H,24,26) |
| InChIKey | BLYVHHKUAGAYEO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.21 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|