C30H40O8 — CID 583809
[10-(1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carbonyl)oxy-4-tricyclo[4.4.0.03,8]decanyl] 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate (PubChem CID 583809) has the molecular formula C30H40O8 and a molecular weight of 528.64 g/mol. Its IUPAC name is [10-(1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carbonyl)oxy-4-tricyclo[4.4.0.03,8]decanyl] 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate.
| Compound Name | [10-(1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carbonyl)oxy-4-tricyclo[4.4.0.03,8]decanyl] 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate |
|---|---|
| PubChem CID | 583809 |
| Molecular Formula | C30H40O8 |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | [10-(1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carbonyl)oxy-4-tricyclo[4.4.0.03,8]decanyl] 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate |
| SMILES | CC12CCC(C(=O)OC3CC4CC5CC(OC(=O)C67CCC(C)(OC6=O)C7(C)C)C4CC53)(C(=O)O1)C2(C)C |
| InChI | InChI=1S/C30H40O8/c1-25(2)27(5)7-9-29(25,23(33)37-27)21(31)35-19-12-15-11-16-13-20(18(15)14-17(16)19)36-22(32)30-10-8-28(6,26(30,3)4)38-24(30)34/h15-20H,7-14H2,1-6H3 |
| InChIKey | NZYPICOEKOLOCZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|