C43H40N4O6S — CID 58382039
9H-fluoren-9-ylmethyl 4-[[10-[4-(2-hydroxypropan-2-yl)phenyl]-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]methoxy]butanoate (PubChem CID 58382039) has the molecular formula C43H40N4O6S and a molecular weight of 740.88 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-[[10-[4-(2-hydroxypropan-2-yl)phenyl]-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]methoxy]butanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 4-[[10-[4-(2-hydroxypropan-2-yl)phenyl]-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]methoxy]butanoate |
|---|---|
| PubChem CID | 58382039 |
| Molecular Formula | C43H40N4O6S |
| Molecular Weight | 740.88 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-[[10-[4-(2-hydroxypropan-2-yl)phenyl]-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]methoxy]butanoate |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2c(-c4ccc(C(C)(C)O)cc4)nc(COCCCC(=O)OCC4c5ccccc5-c5ccccc54)n23)cc1 |
| InChI | InChI=1S/C43H40N4O6S/c1-28-14-20-31(21-15-28)54(50,51)46-23-22-37-42(46)44-25-38-41(29-16-18-30(19-17-29)43(2,3)49)45-39(47(37)38)27-52-24-8-13-40(48)53-26-36-34-11-6-4-9-32(34)33-10-5-7-12-35(33)36/h4-7,9-12,14-23,25,36,49H,8,13,24,26-27H2,1-3H3 |
| InChIKey | CJYKTZCOARLIDZ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.88 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|