C21H14BrN5O3S — CID 58382317
3-[10-bromo-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyridine-2-carbaldehyde (PubChem CID 58382317) has the molecular formula C21H14BrN5O3S and a molecular weight of 496.35 g/mol. Its IUPAC name is 3-[10-bromo-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyridine-2-carbaldehyde.
| Compound Name | 3-[10-bromo-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 58382317 |
| Molecular Formula | C21H14BrN5O3S |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | 3-[10-bromo-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyridine-2-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2c(Br)nc(-c4cccnc4C=O)n23)cc1 |
| InChI | InChI=1S/C21H14BrN5O3S/c1-13-4-6-14(7-5-13)31(29,30)26-10-8-17-21(26)24-11-18-19(22)25-20(27(17)18)15-3-2-9-23-16(15)12-28/h2-12H,1H3 |
| InChIKey | GJGMTJWWOIBNHO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 99.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|