C25H34N6O3Si — CID 58382445
2-[[2-(azidomethyl)-7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58382445) has the molecular formula C25H34N6O3Si and a molecular weight of 494.67 g/mol. Its IUPAC name is 2-[[2-(azidomethyl)-7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(azidomethyl)-7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58382445 |
| Molecular Formula | C25H34N6O3Si |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-[[2-(azidomethyl)-7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]pyrrolo[2,3-b]pyrazin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCc1c(-c2ccc(C3(C)OCCO3)cc2)n(COCC[Si](C)(C)C)c2ncc(CN=[N+]=[N-])nc12 |
| InChI | InChI=1S/C25H34N6O3Si/c1-6-21-22-24(27-15-20(29-22)16-28-30-26)31(17-32-13-14-35(3,4)5)23(21)18-7-9-19(10-8-18)25(2)33-11-12-34-25/h7-10,15H,6,11-14,16-17H2,1-5H3 |
| InChIKey | HJRBNOLKDJYRTR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 107.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|