C29H32N2O4 — CID 58387247
(E)-4-(3-hydroxy-4-methoxyphenyl)-1-[2-[[2-(4-methylpiperazin-1-yl)phenoxy]methyl]phenyl]but-3-en-2-one (PubChem CID 58387247) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is (E)-4-(3-hydroxy-4-methoxyphenyl)-1-[2-[[2-(4-methylpiperazin-1-yl)phenoxy]methyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-(3-hydroxy-4-methoxyphenyl)-1-[2-[[2-(4-methylpiperazin-1-yl)phenoxy]methyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 58387247 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | (E)-4-(3-hydroxy-4-methoxyphenyl)-1-[2-[[2-(4-methylpiperazin-1-yl)phenoxy]methyl]phenyl]but-3-en-2-one |
| SMILES | COc1ccc(/C=C/C(=O)Cc2ccccc2COc2ccccc2N2CCN(C)CC2)cc1O |
| InChI | InChI=1S/C29H32N2O4/c1-30-15-17-31(18-16-30)26-9-5-6-10-28(26)35-21-24-8-4-3-7-23(24)20-25(32)13-11-22-12-14-29(34-2)27(33)19-22/h3-14,19,33H,15-18,20-21H2,1-2H3/b13-11+ |
| InChIKey | QJFAHCCOTSYNTG-ACCUITESSA-N |
| XLogP | 4.56 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|