C35H40N2O7 — CID 58387294
tert-butyl 4-[3-[[2-[(E)-4-(3-acetyloxy-4-methoxyphenyl)-2-oxobut-3-enyl]phenyl]methoxy]phenyl]piperazine-1-carboxylate (PubChem CID 58387294) has the molecular formula C35H40N2O7 and a molecular weight of 600.71 g/mol. Its IUPAC name is tert-butyl 4-[3-[[2-[(E)-4-(3-acetyloxy-4-methoxyphenyl)-2-oxobut-3-enyl]phenyl]methoxy]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[2-[(E)-4-(3-acetyloxy-4-methoxyphenyl)-2-oxobut-3-enyl]phenyl]methoxy]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58387294 |
| Molecular Formula | C35H40N2O7 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | tert-butyl 4-[3-[[2-[(E)-4-(3-acetyloxy-4-methoxyphenyl)-2-oxobut-3-enyl]phenyl]methoxy]phenyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(/C=C/C(=O)Cc2ccccc2COc2cccc(N3CCN(C(=O)OC(C)(C)C)CC3)c2)cc1OC(C)=O |
| InChI | InChI=1S/C35H40N2O7/c1-25(38)43-33-21-26(14-16-32(33)41-5)13-15-30(39)22-27-9-6-7-10-28(27)24-42-31-12-8-11-29(23-31)36-17-19-37(20-18-36)34(40)44-35(2,3)4/h6-16,21,23H,17-20,22,24H2,1-5H3/b15-13+ |
| InChIKey | REHPQPHZKYSGKF-FYWRMAATSA-N |
| XLogP | 6.08 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|