C26H25NO6 — CID 67340660
[2-methoxy-5-[3-[2-[(3-methoxyphenoxy)methyl]anilino]-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 67340660) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is [2-methoxy-5-[3-[2-[(3-methoxyphenoxy)methyl]anilino]-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-5-[3-[2-[(3-methoxyphenoxy)methyl]anilino]-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 67340660 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [2-methoxy-5-[3-[2-[(3-methoxyphenoxy)methyl]anilino]-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | COc1cccc(OCc2ccccc2NC(=O)C=Cc2ccc(OC)c(OC(C)=O)c2)c1 |
| InChI | InChI=1S/C26H25NO6/c1-18(28)33-25-15-19(11-13-24(25)31-3)12-14-26(29)27-23-10-5-4-7-20(23)17-32-22-9-6-8-21(16-22)30-2/h4-16H,17H2,1-3H3,(H,27,29) |
| InChIKey | UXWGZJYWRGMAJS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|