C26H22F3NO5 — CID 67338168
[2-methoxy-5-[(E)-3-oxo-3-[2-[[3-(trifluoromethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] acetate (PubChem CID 67338168) has the molecular formula C26H22F3NO5 and a molecular weight of 485.46 g/mol. Its IUPAC name is [2-methoxy-5-[(E)-3-oxo-3-[2-[[3-(trifluoromethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-5-[(E)-3-oxo-3-[2-[[3-(trifluoromethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 67338168 |
| Molecular Formula | C26H22F3NO5 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [2-methoxy-5-[(E)-3-oxo-3-[2-[[3-(trifluoromethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] acetate |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2COc2cccc(C(F)(F)F)c2)cc1OC(C)=O |
| InChI | InChI=1S/C26H22F3NO5/c1-17(31)35-24-14-18(10-12-23(24)33-2)11-13-25(32)30-22-9-4-3-6-19(22)16-34-21-8-5-7-20(15-21)26(27,28)29/h3-15H,16H2,1-2H3,(H,30,32)/b13-11+ |
| InChIKey | CCAHJFDNVIJQON-ACCUITESSA-N |
| XLogP | 5.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|